| Metilclotiazide | |
|---|---|
| Nomi alternativi | |
| Enduron | |
| Caratteristiche generali | |
| Formula bruta o molecolare | 👁 {\displaystyle {\mathrm {C} {\vphantom {A}}_{\smash[{t}]{9}}\mathrm {H} {\vphantom {A}}_{\smash[{t}]{11}}\mathrm {Cl} {\vphantom {A}}_{\smash[{t}]{2}}\mathrm {N} {\vphantom {A}}_{\smash[{t}]{3}}\mathrm {O} {\vphantom {A}}_{\smash[{t}]{4}}\mathrm {S} {\vphantom {A}}_{\smash[{t}]{2}}}} |
| Massa molecolare (u) | 360,22 |
| Numero CAS | 135-07-9 |
| Numero EINECS | 205-172-2 |
| PubChem | 4121 |
| DrugBank | DBDB00232 |
| SMILES | CN1C(NC2=CC(=C(C=C2S1(=O)=O)S(=O)(=O)N)Cl)CCl |
| Indicazioni di sicurezza | |
| Modifica dati su Wikidata· Manuale | |
La metilclotiazide o meticlotiazide, il cui nome commerciale è Enduron, è un farmaco diuretico di natura tiazidica.[1]
Note
[modifica | modifica wikitesto]- ↑ (EN) Mari J. Wirfs, Hypertension: Primary Essential, in The APRN and PA’s Complete Guide to Prescribing Drug Therapy 2022, Springer, 2022, p.366, ISBN978-0-8261-8549-5.
Altri progetti
[modifica | modifica wikitesto]- 👁 Collabora a Wikimedia Commons
Wikimedia Commons contiene immagini o altri file sul meticlotiazide
